C28H26N2O5 — CID 139721380
4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid (PubChem CID 139721380) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid.
| Compound Name | 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 139721380 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid |
| SMILES | Cc1nc(-c2ccc(C(=O)O)cc2)c(-c2ccc(CCNCC(=O)OCc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C28H26N2O5/c1-19-30-26(22-11-13-24(14-12-22)28(32)33)27(35-19)23-9-7-20(8-10-23)15-16-29-17-25(31)34-18-21-5-3-2-4-6-21/h2-14,29H,15-18H2,1H3,(H,32,33) |
| InChIKey | ZZDYGCYUMUJCRD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|