About 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid
4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid (PubChem CID 139721380) has the molecular formula C28H26N2O5
and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid |
| PubChem CID | 139721380 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid |
| SMILES | Cc1nc(-c2ccc(C(=O)O)cc2)c(-c2ccc(CCNCC(=O)OCc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C28H26N2O5/c1-19-30-26(22-11-13-24(14-12-22)28(32)33)27(35-19)23-9-7-20(8-10-23)15-16-29-17-25(31)34-18-21-5-3-2-4-6-21/h2-14,29H,15-18H2,1H3,(H,32,33) |
| InChIKey | ZZDYGCYUMUJCRD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid?
The IUPAC name of 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid (CID 139721380) is 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid.
What is the SMILES notation for 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid?
The canonical SMILES for 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid is Cc1nc(-c2ccc(C(=O)O)cc2)c(-c2ccc(CCNCC(=O)OCc3ccccc3)cc2)o1.
What is the InChIKey of 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid?
The InChIKey is ZZDYGCYUMUJCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O5/c1-19-30-26(22-11-13-24(14-12-22)28(32)33)27(35-19)23-9-7-20(8-10-23)15-16-29-17-25(31)34-18-21-5-3-2-4-6-21/h2-14,29H,15-18H2,1H3,(H,32,33).
What are the key properties of 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid?
4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid has a molecular weight of 470.53 g/mol, XLogP of 4.89, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-methyl-5-[4-[2-[(2-oxo-2-phenylmethoxyethyl)amino]ethyl]phenyl]-1,3-oxazol-4-yl]benzoic acid is sourced from PubChem (CID 139721380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).