anisole;4-[2-(ethylamino)ethyl]benzoic acid

C18H23NO3 — CID 174444655

IUPACanisole;4-[2-(ethylamino)ethyl]benzoic acid
SMILESCCNCCc1ccc(C(=O)O)cc1.COc1ccccc1
InChIInChI=1S/C11H15NO2.C7H8O/c1-2-12-8-7-9-3-5-10(6-4-9)11(13)14;1-8-7-5-3-2-4-6-7/h3-6,12H,2,7-8H2,1H3,(H,13,14);2-6H,1H3
InChIKeyYILXXCSKUCBKEN-UHFFFAOYSA-N
MW301.39 g/mol
LogP3.23
Rot. Bonds6

About anisole;4-[2-(ethylamino)ethyl]benzoic acid

anisole;4-[2-(ethylamino)ethyl]benzoic acid (PubChem CID 174444655) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is anisole;4-[2-(ethylamino)ethyl]benzoic acid.

Molecular Properties

Compound Nameanisole;4-[2-(ethylamino)ethyl]benzoic acid
PubChem CID174444655
Molecular FormulaC18H23NO3
Molecular Weight301.39 g/mol
Exact Mass301.17
IUPAC Nameanisole;4-[2-(ethylamino)ethyl]benzoic acid
SMILESCCNCCc1ccc(C(=O)O)cc1.COc1ccccc1
InChIInChI=1S/C11H15NO2.C7H8O/c1-2-12-8-7-9-3-5-10(6-4-9)11(13)14;1-8-7-5-3-2-4-6-7/h3-6,12H,2,7-8H2,1H3,(H,13,14);2-6H,1H3
InChIKeyYILXXCSKUCBKEN-UHFFFAOYSA-N
XLogP3.23
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.39
LogP ≤ 53.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze anisole;4-[2-(ethylamino)ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of anisole;4-[2-(ethylamino)ethyl]benzoic acid?
The IUPAC name of anisole;4-[2-(ethylamino)ethyl]benzoic acid (CID 174444655) is anisole;4-[2-(ethylamino)ethyl]benzoic acid.
What is the SMILES notation for anisole;4-[2-(ethylamino)ethyl]benzoic acid?
The canonical SMILES for anisole;4-[2-(ethylamino)ethyl]benzoic acid is CCNCCc1ccc(C(=O)O)cc1.COc1ccccc1.
What is the InChIKey of anisole;4-[2-(ethylamino)ethyl]benzoic acid?
The InChIKey is YILXXCSKUCBKEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C7H8O/c1-2-12-8-7-9-3-5-10(6-4-9)11(13)14;1-8-7-5-3-2-4-6-7/h3-6,12H,2,7-8H2,1H3,(H,13,14);2-6H,1H3.
What are the key properties of anisole;4-[2-(ethylamino)ethyl]benzoic acid?
anisole;4-[2-(ethylamino)ethyl]benzoic acid has a molecular weight of 301.39 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;4-[2-(ethylamino)ethyl]benzoic acid is sourced from PubChem (CID 174444655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).