C18H23NO3 — CID 174444655
anisole;4-[2-(ethylamino)ethyl]benzoic acid (PubChem CID 174444655) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is anisole;4-[2-(ethylamino)ethyl]benzoic acid.
| Compound Name | anisole;4-[2-(ethylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 174444655 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | anisole;4-[2-(ethylamino)ethyl]benzoic acid |
| SMILES | CCNCCc1ccc(C(=O)O)cc1.COc1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C7H8O/c1-2-12-8-7-9-3-5-10(6-4-9)11(13)14;1-8-7-5-3-2-4-6-7/h3-6,12H,2,7-8H2,1H3,(H,13,14);2-6H,1H3 |
| InChIKey | YILXXCSKUCBKEN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|