C31H39ClN2O4 — CID 139722056
6,7-dimethoxy-2-[[1-(4-naphthalen-1-yloxybutyl)piperidin-3-yl]methyl]-3,4-dihydroisoquinolin-1-one;hydrochloride (PubChem CID 139722056) has the molecular formula C31H39ClN2O4 and a molecular weight of 539.12 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[[1-(4-naphthalen-1-yloxybutyl)piperidin-3-yl]methyl]-3,4-dihydroisoquinolin-1-one;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-[[1-(4-naphthalen-1-yloxybutyl)piperidin-3-yl]methyl]-3,4-dihydroisoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 139722056 |
| Molecular Formula | C31H39ClN2O4 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 6,7-dimethoxy-2-[[1-(4-naphthalen-1-yloxybutyl)piperidin-3-yl]methyl]-3,4-dihydroisoquinolin-1-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CC1CCCN(CCCCOc3cccc4ccccc34)C1)CC2.Cl |
| InChI | InChI=1S/C31H38N2O4.ClH/c1-35-29-19-25-14-17-33(31(34)27(25)20-30(29)36-2)22-23-9-8-16-32(21-23)15-5-6-18-37-28-13-7-11-24-10-3-4-12-26(24)28;/h3-4,7,10-13,19-20,23H,5-6,8-9,14-18,21-22H2,1-2H3;1H |
| InChIKey | LUXDLMNVQSKZNM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|