C25H31Br2N3O4 — CID 19803784
2-[[1-[3-(4-amino-3,5-dibromophenoxy)propyl]piperidin-3-yl]methyl]-5,6-dimethoxy-3H-isoindol-1-one (PubChem CID 19803784) has the molecular formula C25H31Br2N3O4 and a molecular weight of 597.35 g/mol. Its IUPAC name is 2-[[1-[3-(4-amino-3,5-dibromophenoxy)propyl]piperidin-3-yl]methyl]-5,6-dimethoxy-3H-isoindol-1-one.
| Compound Name | 2-[[1-[3-(4-amino-3,5-dibromophenoxy)propyl]piperidin-3-yl]methyl]-5,6-dimethoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 19803784 |
| Molecular Formula | C25H31Br2N3O4 |
| Molecular Weight | 597.35 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | 2-[[1-[3-(4-amino-3,5-dibromophenoxy)propyl]piperidin-3-yl]methyl]-5,6-dimethoxy-3H-isoindol-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CC1CCCN(CCCOc3cc(Br)c(N)c(Br)c3)C1)C2 |
| InChI | InChI=1S/C25H31Br2N3O4/c1-32-22-9-17-15-30(25(31)19(17)12-23(22)33-2)14-16-5-3-6-29(13-16)7-4-8-34-18-10-20(26)24(28)21(27)11-18/h9-12,16H,3-8,13-15,28H2,1-2H3 |
| InChIKey | ZNEQZTJKNTURKD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|