C27H36N2O5 — CID 19803774
6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3-methyl-3,4-dihydroisoquinolin-1-one (PubChem CID 19803774) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3-methyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 19803774 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 6,7-dimethoxy-2-[1-[3-(4-methoxyphenoxy)propyl]piperidin-3-yl]-3-methyl-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc(OCCCN2CCCC(N3C(=O)c4cc(OC)c(OC)cc4CC3C)C2)cc1 |
| InChI | InChI=1S/C27H36N2O5/c1-19-15-20-16-25(32-3)26(33-4)17-24(20)27(30)29(19)21-7-5-12-28(18-21)13-6-14-34-23-10-8-22(31-2)9-11-23/h8-11,16-17,19,21H,5-7,12-15,18H2,1-4H3 |
| InChIKey | YZGIJPYQMSUAJH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|