C20H30N2O5 — CID 154913924
formic acid;(1S,5R)-3-[3-(4-methoxyphenoxy)propyl]-9-methyl-3,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 154913924) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is formic acid;(1S,5R)-3-[3-(4-methoxyphenoxy)propyl]-9-methyl-3,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | formic acid;(1S,5R)-3-[3-(4-methoxyphenoxy)propyl]-9-methyl-3,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 154913924 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | formic acid;(1S,5R)-3-[3-(4-methoxyphenoxy)propyl]-9-methyl-3,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | COc1ccc(OCCCN2C[C@H]3CCC[C@@H](C2)N(C)C3=O)cc1.O=CO |
| InChI | InChI=1S/C19H28N2O3.CH2O2/c1-20-16-6-3-5-15(19(20)22)13-21(14-16)11-4-12-24-18-9-7-17(23-2)8-10-18;2-1-3/h7-10,15-16H,3-6,11-14H2,1-2H3;1H,(H,2,3)/t15-,16+;/m1./s1 |
| InChIKey | PUBDYPDQCOIHKI-RCPFAERMSA-N |
| XLogP | 2.11 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|