C33H42N2O5 — CID 139721998
6,7-dimethoxy-2-[[1-[3-(6-methoxynaphthalen-1-yl)oxypropyl]azocan-3-yl]methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 139721998) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[[1-[3-(6-methoxynaphthalen-1-yl)oxypropyl]azocan-3-yl]methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-2-[[1-[3-(6-methoxynaphthalen-1-yl)oxypropyl]azocan-3-yl]methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 139721998 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 6,7-dimethoxy-2-[[1-[3-(6-methoxynaphthalen-1-yl)oxypropyl]azocan-3-yl]methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc2c(OCCCN3CCCCCC(CN4CCc5cc(OC)c(OC)cc5C4=O)C3)cccc2c1 |
| InChI | InChI=1S/C33H42N2O5/c1-37-27-12-13-28-25(19-27)10-7-11-30(28)40-18-8-16-34-15-6-4-5-9-24(22-34)23-35-17-14-26-20-31(38-2)32(39-3)21-29(26)33(35)36/h7,10-13,19-21,24H,4-6,8-9,14-18,22-23H2,1-3H3 |
| InChIKey | PYMSLGUEPRTCKO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|