C18H23NO5 — CID 139722263
ethyl 3-[3-(cyclopentyloxymethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 139722263) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 3-[3-(cyclopentyloxymethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-[3-(cyclopentyloxymethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 139722263 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl 3-[3-(cyclopentyloxymethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1CC(c2cccc(OCOC3CCCC3)c2)=NO1 |
| InChI | InChI=1S/C18H23NO5/c1-2-21-18(20)17-11-16(19-24-17)13-6-5-9-15(10-13)23-12-22-14-7-3-4-8-14/h5-6,9-10,14,17H,2-4,7-8,11-12H2,1H3 |
| InChIKey | RAGBBRAQTQGRFJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|