C18H16BrN3O5 — CID 19495551
3-(3-bromophenyl)-N-(4-ethoxy-2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 19495551) has the molecular formula C18H16BrN3O5 and a molecular weight of 434.25 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-(4-ethoxy-2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-bromophenyl)-N-(4-ethoxy-2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 19495551 |
| Molecular Formula | C18H16BrN3O5 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 3-(3-bromophenyl)-N-(4-ethoxy-2-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC(c3cccc(Br)c3)=NO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16BrN3O5/c1-2-26-13-6-7-14(16(9-13)22(24)25)20-18(23)17-10-15(21-27-17)11-4-3-5-12(19)8-11/h3-9,17H,2,10H2,1H3,(H,20,23) |
| InChIKey | WBJVXPWGYVKBSB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|