C64H46BF24IO2 — CID 139729164
bis[5-(4-cyclohexylphenyl)furan-2-yl]iodanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 139729164) has the molecular formula C64H46BF24IO2 and a molecular weight of 1440.74 g/mol. Its IUPAC name is bis[5-(4-cyclohexylphenyl)furan-2-yl]iodanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | bis[5-(4-cyclohexylphenyl)furan-2-yl]iodanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 139729164 |
| Molecular Formula | C64H46BF24IO2 |
| Molecular Weight | 1440.74 g/mol |
| Exact Mass | 1440.23 |
| IUPAC Name | bis[5-(4-cyclohexylphenyl)furan-2-yl]iodanium;tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.c1cc(C2CCCCC2)ccc1-c1ccc([I+]c2ccc(-c3ccc(C4CCCCC4)cc3)o2)o1 |
| InChI | InChI=1S/C32H12BF24.C32H34IO2/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;1-3-7-23(8-4-1)25-11-15-27(16-12-25)29-19-21-31(34-29)33-32-22-20-30(35-32)28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-12H;11-24H,1-10H2/q-1;+1 |
| InChIKey | UFPDVYJRPXZRPJ-UHFFFAOYSA-N |
| XLogP | 17.64 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1440.74 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|