C25H24ClN2O6S4+ — CID 139729405
2-(benzo[e][1,3]benzothiazol-1-ium-1-ylmethyl)-3-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]propane-1-sulfonic acid (PubChem CID 139729405) has the molecular formula C25H24ClN2O6S4+ and a molecular weight of 612.20 g/mol. Its IUPAC name is 2-(benzo[e][1,3]benzothiazol-1-ium-1-ylmethyl)-3-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]propane-1-sulfonic acid.
| Compound Name | 2-(benzo[e][1,3]benzothiazol-1-ium-1-ylmethyl)-3-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139729405 |
| Molecular Formula | C25H24ClN2O6S4+ |
| Molecular Weight | 612.20 g/mol |
| Exact Mass | 611.02 |
| IUPAC Name | 2-(benzo[e][1,3]benzothiazol-1-ium-1-ylmethyl)-3-[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCN1C(=CC(C[n+]2csc3ccc4ccccc4c32)CS(=O)(=O)O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H23ClN2O6S4/c26-19-7-9-22-21(13-19)28(10-3-11-37(29,30)31)24(36-22)12-17(15-38(32,33)34)14-27-16-35-23-8-6-18-4-1-2-5-20(18)25(23)27/h1-2,4-9,12-13,16-17H,3,10-11,14-15H2,(H-,29,30,31,32,33,34)/p+1 |
| InChIKey | TZRPAJQNTLGPTJ-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.20 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|