C29H24O5 — CID 139729884
[4-benzoyloxy-3-(3-hydroxy-1-phenylpropyl)phenyl] benzoate (PubChem CID 139729884) has the molecular formula C29H24O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is [4-benzoyloxy-3-(3-hydroxy-1-phenylpropyl)phenyl] benzoate.
| Compound Name | [4-benzoyloxy-3-(3-hydroxy-1-phenylpropyl)phenyl] benzoate |
|---|---|
| PubChem CID | 139729884 |
| Molecular Formula | C29H24O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [4-benzoyloxy-3-(3-hydroxy-1-phenylpropyl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(OC(=O)c2ccccc2)c(C(CCO)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H24O5/c30-19-18-25(21-10-4-1-5-11-21)26-20-24(33-28(31)22-12-6-2-7-13-22)16-17-27(26)34-29(32)23-14-8-3-9-15-23/h1-17,20,25,30H,18-19H2 |
| InChIKey | PQKWCDBIFRUCBO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|