C25H23F5 — CID 139729992
1-[2-[3,5-difluoro-4-[(E)-pent-1-enyl]phenyl]ethynyl]-2,3-difluoro-4-(4-fluorocyclohexyl)benzene (PubChem CID 139729992) has the molecular formula C25H23F5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[2-[3,5-difluoro-4-[(E)-pent-1-enyl]phenyl]ethynyl]-2,3-difluoro-4-(4-fluorocyclohexyl)benzene.
| Compound Name | 1-[2-[3,5-difluoro-4-[(E)-pent-1-enyl]phenyl]ethynyl]-2,3-difluoro-4-(4-fluorocyclohexyl)benzene |
|---|---|
| PubChem CID | 139729992 |
| Molecular Formula | C25H23F5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[2-[3,5-difluoro-4-[(E)-pent-1-enyl]phenyl]ethynyl]-2,3-difluoro-4-(4-fluorocyclohexyl)benzene |
| SMILES | CCC/C=C/c1c(F)cc(C#Cc2ccc(C3CCC(F)CC3)c(F)c2F)cc1F |
| InChI | InChI=1S/C25H23F5/c1-2-3-4-5-21-22(27)14-16(15-23(21)28)6-7-18-10-13-20(25(30)24(18)29)17-8-11-19(26)12-9-17/h4-5,10,13-15,17,19H,2-3,8-9,11-12H2,1H3/b5-4+ |
| InChIKey | KNPIAYPGCPLDHK-SNAWJCMRSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|