C37H36O5 — CID 139730206
4-[[4-hydroxy-3,5-bis[(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol (PubChem CID 139730206) has the molecular formula C37H36O5 and a molecular weight of 560.69 g/mol. Its IUPAC name is 4-[[4-hydroxy-3,5-bis[(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[[4-hydroxy-3,5-bis[(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 139730206 |
| Molecular Formula | C37H36O5 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 4-[[4-hydroxy-3,5-bis[(4-hydroxyphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(c2cc(C)c(O)c(C)c2)c2cc(Cc3ccc(O)cc3)c(O)c(Cc3ccc(O)cc3)c2)cc(C)c1O |
| InChI | InChI=1S/C37H36O5/c1-21-13-27(14-22(2)35(21)40)34(28-15-23(3)36(41)24(4)16-28)29-19-30(17-25-5-9-32(38)10-6-25)37(42)31(20-29)18-26-7-11-33(39)12-8-26/h5-16,19-20,34,38-42H,17-18H2,1-4H3 |
| InChIKey | UMWSQNVIIOYFRM-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|