C40H13BF20N2O3 — CID 139731470
cyanomethyl 1-phenacylpyridin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139731470) has the molecular formula C40H13BF20N2O3 and a molecular weight of 960.33 g/mol. Its IUPAC name is cyanomethyl 1-phenacylpyridin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | cyanomethyl 1-phenacylpyridin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139731470 |
| Molecular Formula | C40H13BF20N2O3 |
| Molecular Weight | 960.33 g/mol |
| Exact Mass | 960.07 |
| IUPAC Name | cyanomethyl 1-phenacylpyridin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.N#CCOC(=O)c1cccc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C16H13N2O3/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;17-9-11-21-16(20)14-8-4-5-10-18(14)12-15(19)13-6-2-1-3-7-13/h;1-8,10H,11-12H2/q-1;+1 |
| InChIKey | DZRQWTMWCYNZMY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.33 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|