C12H10Cl2N+ — CID 139731587
1-benzyl-2,4-dichloropyridin-1-ium (PubChem CID 139731587) has the molecular formula C12H10Cl2N+ and a molecular weight of 239.13 g/mol. Its IUPAC name is 1-benzyl-2,4-dichloropyridin-1-ium.
| Compound Name | 1-benzyl-2,4-dichloropyridin-1-ium |
|---|---|
| PubChem CID | 139731587 |
| Molecular Formula | C12H10Cl2N+ |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1-benzyl-2,4-dichloropyridin-1-ium |
| SMILES | Clc1cc[n+](Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N/c13-11-6-7-15(12(14)8-11)9-10-4-2-1-3-5-10/h1-8H,9H2/q+1 |
| InChIKey | MWGIAAFNIMVRFE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|