C12H15ClN3+ — CID 162218182
1-benzylpyridin-1-ium-2,4-diamine;hydrochloride (PubChem CID 162218182) has the molecular formula C12H15ClN3+ and a molecular weight of 236.73 g/mol. Its IUPAC name is 1-benzylpyridin-1-ium-2,4-diamine;hydrochloride.
| Compound Name | 1-benzylpyridin-1-ium-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 162218182 |
| Molecular Formula | C12H15ClN3+ |
| Molecular Weight | 236.73 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-benzylpyridin-1-ium-2,4-diamine;hydrochloride |
| SMILES | Cl.Nc1cc[n+](Cc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C12H13N3.ClH/c13-11-6-7-15(12(14)8-11)9-10-4-2-1-3-5-10;/h1-8H,9H2,(H3,13,14);1H/p+1 |
| InChIKey | WCBFZPBQALOJCS-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|