C24H20N2P+ — CID 139734338
(3,3-dicyano-2-methylprop-2-enyl)-triphenylphosphanium (PubChem CID 139734338) has the molecular formula C24H20N2P+ and a molecular weight of 367.41 g/mol. Its IUPAC name is (3,3-dicyano-2-methylprop-2-enyl)-triphenylphosphanium.
| Compound Name | (3,3-dicyano-2-methylprop-2-enyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 139734338 |
| Molecular Formula | C24H20N2P+ |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (3,3-dicyano-2-methylprop-2-enyl)-triphenylphosphanium |
| SMILES | CC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=C(C#N)C#N |
| InChI | InChI=1S/C24H20N2P/c1-20(21(17-25)18-26)19-27(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16H,19H2,1H3/q+1 |
| InChIKey | FTJTUDZAVOIWKG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|