C18H17N2+ — CID 139737328
1,3-dibenzylpyrazin-1-ium (PubChem CID 139737328) has the molecular formula C18H17N2+ and a molecular weight of 261.35 g/mol. Its IUPAC name is 1,3-dibenzylpyrazin-1-ium.
| Compound Name | 1,3-dibenzylpyrazin-1-ium |
|---|---|
| PubChem CID | 139737328 |
| Molecular Formula | C18H17N2+ |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1,3-dibenzylpyrazin-1-ium |
| SMILES | c1ccc(Cc2c[n+](Cc3ccccc3)ccn2)cc1 |
| InChI | InChI=1S/C18H17N2/c1-3-7-16(8-4-1)13-18-15-20(12-11-19-18)14-17-9-5-2-6-10-17/h1-12,15H,13-14H2/q+1 |
| InChIKey | VDQLCMRFFVUNER-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|