About 6-benzyl-1,6-naphthyridin-6-ium bromide
6-benzyl-1,6-naphthyridin-6-ium bromide (PubChem CID 13193865) has the molecular formula C15H13BrN2
and a molecular weight of 301.19 g/mol. Its IUPAC name is 6-benzyl-1,6-naphthyridin-6-ium bromide.
Molecular Properties
| Compound Name | 6-benzyl-1,6-naphthyridin-6-ium bromide |
| PubChem CID | 13193865 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-benzyl-1,6-naphthyridin-6-ium bromide |
| SMILES | [Br-].c1ccc(C[n+]2ccc3ncccc3c2)cc1 |
| InChI | InChI=1S/C15H13N2.BrH/c1-2-5-13(6-3-1)11-17-10-8-15-14(12-17)7-4-9-16-15;/h1-10,12H,11H2;1H/q+1;/p-1 |
| InChIKey | RZAFRZXBKIOOTF-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-1,6-naphthyridin-6-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-1,6-naphthyridin-6-ium bromide?
The IUPAC name of 6-benzyl-1,6-naphthyridin-6-ium bromide (CID 13193865) is 6-benzyl-1,6-naphthyridin-6-ium bromide.
What is the SMILES notation for 6-benzyl-1,6-naphthyridin-6-ium bromide?
The canonical SMILES for 6-benzyl-1,6-naphthyridin-6-ium bromide is [Br-].c1ccc(C[n+]2ccc3ncccc3c2)cc1.
What is the InChIKey of 6-benzyl-1,6-naphthyridin-6-ium bromide?
The InChIKey is RZAFRZXBKIOOTF-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H13N2.BrH/c1-2-5-13(6-3-1)11-17-10-8-15-14(12-17)7-4-9-16-15;/h1-10,12H,11H2;1H/q+1;/p-1.
What are the key properties of 6-benzyl-1,6-naphthyridin-6-ium bromide?
6-benzyl-1,6-naphthyridin-6-ium bromide has a molecular weight of 301.19 g/mol, XLogP of -0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-1,6-naphthyridin-6-ium bromide is sourced from PubChem (CID 13193865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).