C38H9BF26N2O — CID 139737393
1-[3,5-bis(trifluoromethyl)phenyl]-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139737393) has the molecular formula C38H9BF26N2O and a molecular weight of 1014.26 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139737393 |
| Molecular Formula | C38H9BF26N2O |
| Molecular Weight | 1014.26 g/mol |
| Exact Mass | 1014.04 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccncc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24BF20.C14H9F6N2O/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-13(16,17)10-5-9(6-11(7-10)14(18,19)20)12(23)8-22-3-1-21-2-4-22/h;1-7H,8H2/q-1;+1 |
| InChIKey | OXICXAOCVISHRN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.26 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|