C52H19BF20N2O — CID 139736899
1-pentacen-6-yl-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139736899) has the molecular formula C52H19BF20N2O and a molecular weight of 1078.51 g/mol. Its IUPAC name is 1-pentacen-6-yl-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-pentacen-6-yl-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139736899 |
| Molecular Formula | C52H19BF20N2O |
| Molecular Weight | 1078.51 g/mol |
| Exact Mass | 1078.13 |
| IUPAC Name | 1-pentacen-6-yl-2-pyrazin-1-ium-1-ylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccncc1)c1c2cc3ccccc3cc2cc2cc3ccccc3cc12 |
| InChI | InChI=1S/C28H19N2O.C24BF20/c31-27(18-30-11-9-29-10-12-30)28-25-16-21-7-3-1-5-19(21)13-23(25)15-24-14-20-6-2-4-8-22(20)17-26(24)28;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-17H,18H2;/q+1;-1 |
| InChIKey | FLZAYRFGOOBCBS-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.51 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|