C36H11BF20N2OS — CID 139737992
2-pyrazin-1-ium-1-yl-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139737992) has the molecular formula C36H11BF20N2OS and a molecular weight of 910.34 g/mol. Its IUPAC name is 2-pyrazin-1-ium-1-yl-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-pyrazin-1-ium-1-yl-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139737992 |
| Molecular Formula | C36H11BF20N2OS |
| Molecular Weight | 910.34 g/mol |
| Exact Mass | 910.04 |
| IUPAC Name | 2-pyrazin-1-ium-1-yl-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccncc1)c1ccccc1S |
| InChI | InChI=1S/C24BF20.C12H10N2OS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-11(9-14-7-5-13-6-8-14)10-3-1-2-4-12(10)16/h;1-8H,9H2/q-1;/p+1 |
| InChIKey | BVVJPVGCFHRLHF-UHFFFAOYSA-O |
| XLogP | 7.39 |
| TPSA | 33.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.34 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|