C42H14BF20N3O4 — CID 139737623
(3-nitrophenyl) 4-benzylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139737623) has the molecular formula C42H14BF20N3O4 and a molecular weight of 1015.36 g/mol. Its IUPAC name is (3-nitrophenyl) 4-benzylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (3-nitrophenyl) 4-benzylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139737623 |
| Molecular Formula | C42H14BF20N3O4 |
| Molecular Weight | 1015.36 g/mol |
| Exact Mass | 1015.08 |
| IUPAC Name | (3-nitrophenyl) 4-benzylpyrazin-4-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(Oc1cccc([N+](=O)[O-])c1)c1c[n+](Cc2ccccc2)ccn1 |
| InChI | InChI=1S/C24BF20.C18H14N3O4/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;22-18(25-16-8-4-7-15(11-16)21(23)24)17-13-20(10-9-19-17)12-14-5-2-1-3-6-14/h;1-11,13H,12H2/q-1;+1 |
| InChIKey | CHTDXJHUQICHGA-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.36 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|