C23H24N2O5 — CID 139743788
butyl 2-[6-[(4-cyanobenzoyl)amino]-4-hydroxy-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 139743788) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is butyl 2-[6-[(4-cyanobenzoyl)amino]-4-hydroxy-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | butyl 2-[6-[(4-cyanobenzoyl)amino]-4-hydroxy-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 139743788 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | butyl 2-[6-[(4-cyanobenzoyl)amino]-4-hydroxy-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CCCCOC(=O)CC1COc2ccc(NC(=O)c3ccc(C#N)cc3)cc2C1O |
| InChI | InChI=1S/C23H24N2O5/c1-2-3-10-29-21(26)11-17-14-30-20-9-8-18(12-19(20)22(17)27)25-23(28)16-6-4-15(13-24)5-7-16/h4-9,12,17,22,27H,2-3,10-11,14H2,1H3,(H,25,28) |
| InChIKey | UXJGFLLRQYRSFM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|