C21H24ClN3OS — CID 139743927
2-(4-chlorophenyl)-4-(3-piperazin-1-ylpropyl)-1,4-benzothiazin-3-one (PubChem CID 139743927) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(3-piperazin-1-ylpropyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-(4-chlorophenyl)-4-(3-piperazin-1-ylpropyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 139743927 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(3-piperazin-1-ylpropyl)-1,4-benzothiazin-3-one |
| SMILES | O=C1C(c2ccc(Cl)cc2)Sc2ccccc2N1CCCN1CCNCC1 |
| InChI | InChI=1S/C21H24ClN3OS/c22-17-8-6-16(7-9-17)20-21(26)25(18-4-1-2-5-19(18)27-20)13-3-12-24-14-10-23-11-15-24/h1-2,4-9,20,23H,3,10-15H2 |
| InChIKey | ZPYIBPYKNJSEAU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |