C37H10BF20NO2S — CID 139744313
4-(1,3-benzothiazol-3-ium-3-yloxy)phenol;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139744313) has the molecular formula C37H10BF20NO2S and a molecular weight of 923.33 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-3-ium-3-yloxy)phenol;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 4-(1,3-benzothiazol-3-ium-3-yloxy)phenol;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139744313 |
| Molecular Formula | C37H10BF20NO2S |
| Molecular Weight | 923.33 g/mol |
| Exact Mass | 923.02 |
| IUPAC Name | 4-(1,3-benzothiazol-3-ium-3-yloxy)phenol;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.Oc1ccc(O[n+]2csc3ccccc32)cc1 |
| InChI | InChI=1S/C24BF20.C13H9NO2S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-10-5-7-11(8-6-10)16-14-9-17-13-4-2-1-3-12(13)14/h;1-9H/q-1;/p+1 |
| InChIKey | MOYZFKFFKMESEK-UHFFFAOYSA-O |
| XLogP | 8.58 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.33 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|