methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate

C11H20O5 — CID 139745290

IUPACmethyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate
SMILESC=C(COCC(C)OCC(C)O)C(=O)OC
InChIInChI=1S/C11H20O5/c1-8(11(13)14-4)5-15-7-10(3)16-6-9(2)12/h9-10,12H,1,5-7H2,2-4H3
InChIKeyVKBBRQAHQPUXCR-UHFFFAOYSA-N
MW232.28 g/mol
LogP0.52
Rot. Bonds8

About methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate

methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate (PubChem CID 139745290) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate
PubChem CID139745290
Molecular FormulaC11H20O5
Molecular Weight232.28 g/mol
Exact Mass232.13
IUPAC Namemethyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate
SMILESC=C(COCC(C)OCC(C)O)C(=O)OC
InChIInChI=1S/C11H20O5/c1-8(11(13)14-4)5-15-7-10(3)16-6-9(2)12/h9-10,12H,1,5-7H2,2-4H3
InChIKeyVKBBRQAHQPUXCR-UHFFFAOYSA-N
XLogP0.52
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 50.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate?
The IUPAC name of methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate (CID 139745290) is methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate?
The canonical SMILES for methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate is C=C(COCC(C)OCC(C)O)C(=O)OC.
What is the InChIKey of methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate?
The InChIKey is VKBBRQAHQPUXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-8(11(13)14-4)5-15-7-10(3)16-6-9(2)12/h9-10,12H,1,5-7H2,2-4H3.
What are the key properties of methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate?
methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate has a molecular weight of 232.28 g/mol, XLogP of 0.52, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2-hydroxypropoxy)propoxymethyl]prop-2-enoate is sourced from PubChem (CID 139745290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).