C41H20BF20NO2S — CID 139746014
cyclohexyl 3-benzyl-1,3-thiazol-3-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139746014) has the molecular formula C41H20BF20NO2S and a molecular weight of 981.45 g/mol. Its IUPAC name is cyclohexyl 3-benzyl-1,3-thiazol-3-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | cyclohexyl 3-benzyl-1,3-thiazol-3-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139746014 |
| Molecular Formula | C41H20BF20NO2S |
| Molecular Weight | 981.45 g/mol |
| Exact Mass | 981.10 |
| IUPAC Name | cyclohexyl 3-benzyl-1,3-thiazol-3-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(OC1CCCCC1)c1scc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C24BF20.C17H20NO2S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;19-17(20-15-9-5-2-6-10-15)16-18(11-12-21-16)13-14-7-3-1-4-8-14/h;1,3-4,7-8,11-12,15H,2,5-6,9-10,13H2/q-1;+1 |
| InChIKey | NWORJEHULQWEPV-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.45 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|