C31H25N3O5 — CID 139746733
ethyl 2-azido-3-(3,4-dinaphthalen-2-yloxyphenyl)-3-hydroxypropanoate (PubChem CID 139746733) has the molecular formula C31H25N3O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is ethyl 2-azido-3-(3,4-dinaphthalen-2-yloxyphenyl)-3-hydroxypropanoate.
| Compound Name | ethyl 2-azido-3-(3,4-dinaphthalen-2-yloxyphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 139746733 |
| Molecular Formula | C31H25N3O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | ethyl 2-azido-3-(3,4-dinaphthalen-2-yloxyphenyl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(N=[N+]=[N-])C(O)c1ccc(Oc2ccc3ccccc3c2)c(Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C31H25N3O5/c1-2-37-31(36)29(33-34-32)30(35)24-13-16-27(38-25-14-11-20-7-3-5-9-22(20)17-25)28(19-24)39-26-15-12-21-8-4-6-10-23(21)18-26/h3-19,29-30,35H,2H2,1H3 |
| InChIKey | YBYTZXNCENSYBP-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|