C23H35NO4S — CID 139747386
5,7-dimethoxy-3-[2-(6-piperidin-1-ylhexylsulfanyl)ethyl]-3H-2-benzofuran-1-one (PubChem CID 139747386) has the molecular formula C23H35NO4S and a molecular weight of 421.60 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[2-(6-piperidin-1-ylhexylsulfanyl)ethyl]-3H-2-benzofuran-1-one.
| Compound Name | 5,7-dimethoxy-3-[2-(6-piperidin-1-ylhexylsulfanyl)ethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139747386 |
| Molecular Formula | C23H35NO4S |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 5,7-dimethoxy-3-[2-(6-piperidin-1-ylhexylsulfanyl)ethyl]-3H-2-benzofuran-1-one |
| SMILES | COc1cc(OC)c2c(c1)C(CCSCCCCCCN1CCCCC1)OC2=O |
| InChI | InChI=1S/C23H35NO4S/c1-26-18-16-19-20(28-23(25)22(19)21(17-18)27-2)10-15-29-14-9-4-3-6-11-24-12-7-5-8-13-24/h16-17,20H,3-15H2,1-2H3 |
| InChIKey | HZWAHJCVRJECOK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|