C24H37NO6 — CID 139691285
3-(13-hydroxy-10-hydroxyiminotetradecyl)-5,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 139691285) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is 3-(13-hydroxy-10-hydroxyiminotetradecyl)-5,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(13-hydroxy-10-hydroxyiminotetradecyl)-5,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139691285 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-(13-hydroxy-10-hydroxyiminotetradecyl)-5,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1cc(OC)c2c(c1)C(CCCCCCCCCC(CCC(C)O)=NO)OC2=O |
| InChI | InChI=1S/C24H37NO6/c1-17(26)13-14-18(25-28)11-9-7-5-4-6-8-10-12-21-20-15-19(29-2)16-22(30-3)23(20)24(27)31-21/h15-17,21,26,28H,4-14H2,1-3H3 |
| InChIKey | PASSWYNDBRGYAW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|