C27H42O8 — CID 139691281
3-(13-hydroxy-10-oxotetradecyl)-7-methoxy-5-(2-methoxyethoxymethoxy)-3H-2-benzofuran-1-one (PubChem CID 139691281) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is 3-(13-hydroxy-10-oxotetradecyl)-7-methoxy-5-(2-methoxyethoxymethoxy)-3H-2-benzofuran-1-one.
| Compound Name | 3-(13-hydroxy-10-oxotetradecyl)-7-methoxy-5-(2-methoxyethoxymethoxy)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139691281 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 3-(13-hydroxy-10-oxotetradecyl)-7-methoxy-5-(2-methoxyethoxymethoxy)-3H-2-benzofuran-1-one |
| SMILES | COCCOCOc1cc(OC)c2c(c1)C(CCCCCCCCCC(=O)CCC(C)O)OC2=O |
| InChI | InChI=1S/C27H42O8/c1-20(28)13-14-21(29)11-9-7-5-4-6-8-10-12-24-23-17-22(34-19-33-16-15-31-2)18-25(32-3)26(23)27(30)35-24/h17-18,20,24,28H,4-16,19H2,1-3H3 |
| InChIKey | CPYYXXJTIVYZAT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|