C24H28Cl2N2O2S — CID 139748881
2-(4-benzhydrylpiperazin-1-yl)ethyl thiophene-2-carboxylate;dihydrochloride (PubChem CID 139748881) has the molecular formula C24H28Cl2N2O2S and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)ethyl thiophene-2-carboxylate;dihydrochloride.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)ethyl thiophene-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 139748881 |
| Molecular Formula | C24H28Cl2N2O2S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)ethyl thiophene-2-carboxylate;dihydrochloride |
| SMILES | Cl.Cl.O=C(OCCN1CCN(C(c2ccccc2)c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C24H26N2O2S.2ClH/c27-24(22-12-7-19-29-22)28-18-17-25-13-15-26(16-14-25)23(20-8-3-1-4-9-20)21-10-5-2-6-11-21;;/h1-12,19,23H,13-18H2;2*1H |
| InChIKey | BAGZCHZNUWRZCN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |