C25H27N3O2S — CID 6381091
1-(4-benzhydrylpiperazin-1-yl)-2-[(Z)-1-thiophen-2-ylethylideneamino]oxyethanone (PubChem CID 6381091) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-[(Z)-1-thiophen-2-ylethylideneamino]oxyethanone.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-[(Z)-1-thiophen-2-ylethylideneamino]oxyethanone |
|---|---|
| PubChem CID | 6381091 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-[(Z)-1-thiophen-2-ylethylideneamino]oxyethanone |
| SMILES | C/C(=N/OCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C25H27N3O2S/c1-20(23-13-8-18-31-23)26-30-19-24(29)27-14-16-28(17-15-27)25(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-13,18,25H,14-17,19H2,1H3/b26-20- |
| InChIKey | JTEPWNNIAPRRSX-QOMWVZHYSA-N |
| XLogP | 4.42 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|