C28H45NO6 — CID 139749825
tert-butyl (3R)-3-[[(2S,3R)-3-hydroxy-4-methoxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]dodecanoate (PubChem CID 139749825) has the molecular formula C28H45NO6 and a molecular weight of 491.67 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(2S,3R)-3-hydroxy-4-methoxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]dodecanoate.
| Compound Name | tert-butyl (3R)-3-[[(2S,3R)-3-hydroxy-4-methoxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]dodecanoate |
|---|---|
| PubChem CID | 139749825 |
| Molecular Formula | C28H45NO6 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | tert-butyl (3R)-3-[[(2S,3R)-3-hydroxy-4-methoxy-4-oxo-1-phenylbutan-2-yl]carbamoyl]dodecanoate |
| SMILES | CCCCCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C28H45NO6/c1-6-7-8-9-10-11-15-18-22(20-24(30)35-28(2,3)4)26(32)29-23(25(31)27(33)34-5)19-21-16-13-12-14-17-21/h12-14,16-17,22-23,25,31H,6-11,15,18-20H2,1-5H3,(H,29,32)/t22-,23+,25-/m1/s1 |
| InChIKey | CKFUFVMYJZZFJG-GIFXNVAJSA-N |
| XLogP | 4.74 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|