C25H45NO7 — CID 139749728
tert-butyl (3R)-3-[[(2R,3R)-1,3-diacetyloxybutan-2-yl]carbamoyl]dodecanoate (PubChem CID 139749728) has the molecular formula C25H45NO7 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(2R,3R)-1,3-diacetyloxybutan-2-yl]carbamoyl]dodecanoate.
| Compound Name | tert-butyl (3R)-3-[[(2R,3R)-1,3-diacetyloxybutan-2-yl]carbamoyl]dodecanoate |
|---|---|
| PubChem CID | 139749728 |
| Molecular Formula | C25H45NO7 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | tert-butyl (3R)-3-[[(2R,3R)-1,3-diacetyloxybutan-2-yl]carbamoyl]dodecanoate |
| SMILES | CCCCCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N[C@H](COC(C)=O)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C25H45NO7/c1-8-9-10-11-12-13-14-15-21(16-23(29)33-25(5,6)7)24(30)26-22(17-31-19(3)27)18(2)32-20(4)28/h18,21-22H,8-17H2,1-7H3,(H,26,30)/t18-,21-,22-/m1/s1 |
| InChIKey | HBEUKYGKLVXONH-STZQEDGTSA-N |
| XLogP | 4.47 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|