C29H53NO7 — CID 139749878
1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate (PubChem CID 139749878) has the molecular formula C29H53NO7 and a molecular weight of 527.74 g/mol. Its IUPAC name is 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate.
| Compound Name | 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 139749878 |
| Molecular Formula | C29H53NO7 |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | 1-O-butyl 3-O-ethyl (2S)-2-[[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]undecanoyl]amino]-2-propan-2-ylpropanedioate |
| SMILES | CCCCCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N[C@@](C(=O)OCC)(C(=O)OCCCC)C(C)C |
| InChI | InChI=1S/C29H53NO7/c1-9-12-14-15-16-17-18-19-23(21-24(31)37-28(6,7)8)25(32)30-29(22(4)5,26(33)35-11-3)27(34)36-20-13-10-2/h22-23H,9-21H2,1-8H3,(H,30,32)/t23-,29+/m1/s1 |
| InChIKey | LWENZTRYMUTSMK-BTYSJIOQSA-N |
| XLogP | 5.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|