C28H39N3O2 — CID 139751031
3-[6-(dimethylamino)-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-3-oxopropanamide (PubChem CID 139751031) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 3-[6-(dimethylamino)-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-3-oxopropanamide.
| Compound Name | 3-[6-(dimethylamino)-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 139751031 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 3-[6-(dimethylamino)-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-N-[2,6-di(propan-2-yl)phenyl]-3-oxopropanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CC(=O)N1c2ccc(N(C)C)cc2CCC1(C)C |
| InChI | InChI=1S/C28H39N3O2/c1-18(2)22-10-9-11-23(19(3)4)27(22)29-25(32)17-26(33)31-24-13-12-21(30(7)8)16-20(24)14-15-28(31,5)6/h9-13,16,18-19H,14-15,17H2,1-8H3,(H,29,32) |
| InChIKey | UHTWPTAXSXSAQP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|