C11H20O2Si — CID 139751117
ethyl 2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate (PubChem CID 139751117) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is ethyl 2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139751117 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl 2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C11H20O2Si/c1-5-13-11(12)10-8-9(10)6-7-14(2,3)4/h6-7,9-10H,5,8H2,1-4H3/b7-6+ |
| InChIKey | CEAXMHKCBQFWPD-VOTSOKGWSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|