C13H24O2Si — CID 44596722
cis-tert-butyl (1R,2R)-2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate (PubChem CID 44596722) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is cis-tert-butyl (1R,2R)-2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,2R)-2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 44596722 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cis-tert-butyl (1R,2R)-2-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C13H24O2Si/c1-13(2,3)15-12(14)11-9-10(11)7-8-16(4,5)6/h7-8,10-11H,9H2,1-6H3/b8-7+/t10-,11-/m1/s1 |
| InChIKey | ORSOJTUSISARCY-QSNNZYTBSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|