C16H5F19O3 — CID 139751161
4-[1,1,1,2,3,4,5,5,5-nonafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pentan-2-yl]oxybenzoic acid (PubChem CID 139751161) has the molecular formula C16H5F19O3 and a molecular weight of 606.18 g/mol. Its IUPAC name is 4-[1,1,1,2,3,4,5,5,5-nonafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pentan-2-yl]oxybenzoic acid.
| Compound Name | 4-[1,1,1,2,3,4,5,5,5-nonafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pentan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 139751161 |
| Molecular Formula | C16H5F19O3 |
| Molecular Weight | 606.18 g/mol |
| Exact Mass | 605.99 |
| IUPAC Name | 4-[1,1,1,2,3,4,5,5,5-nonafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pentan-2-yl]oxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC(F)(C(F)(F)F)C(F)(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H5F19O3/c17-8(9(18,12(21,22)23)13(24,25)26,10(19,14(27,28)29)15(30,31)32)11(20,16(33,34)35)38-6-3-1-5(2-4-6)7(36)37/h1-4H,(H,36,37) |
| InChIKey | QZDGNWQHIMSOLL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.18 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |