C22H27N3O4 — CID 139751384
(4R)-5-amino-4-[[(2S)-2-(dibenzylamino)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 139751384) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (4R)-5-amino-4-[[(2S)-2-(dibenzylamino)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4R)-5-amino-4-[[(2S)-2-(dibenzylamino)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139751384 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (4R)-5-amino-4-[[(2S)-2-(dibenzylamino)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@@H](C(=O)N[C@H](CCC(=O)O)C(N)=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H27N3O4/c1-16(22(29)24-19(21(23)28)12-13-20(26)27)25(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18/h2-11,16,19H,12-15H2,1H3,(H2,23,28)(H,24,29)(H,26,27)/t16-,19+/m0/s1 |
| InChIKey | PICRCNKAFZLPTP-QFBILLFUSA-N |
| XLogP | 1.91 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |