C11H13ClN2O3S — CID 139752478
5-(chloromethyl)-5-methyl-3-(pyridin-2-ylmethylsulfonyl)-4H-1,2-oxazole (PubChem CID 139752478) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 5-(chloromethyl)-5-methyl-3-(pyridin-2-ylmethylsulfonyl)-4H-1,2-oxazole.
| Compound Name | 5-(chloromethyl)-5-methyl-3-(pyridin-2-ylmethylsulfonyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 139752478 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 5-(chloromethyl)-5-methyl-3-(pyridin-2-ylmethylsulfonyl)-4H-1,2-oxazole |
| SMILES | CC1(CCl)CC(S(=O)(=O)Cc2ccccn2)=NO1 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-11(8-12)6-10(14-17-11)18(15,16)7-9-4-2-3-5-13-9/h2-5H,6-8H2,1H3 |
| InChIKey | FEEDUOAXAUONAS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|