C43H21BF20O4S — CID 139752811
[2-(2-benzoylphenyl)-2-oxoethyl]-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139752811) has the molecular formula C43H21BF20O4S and a molecular weight of 1024.48 g/mol. Its IUPAC name is [2-(2-benzoylphenyl)-2-oxoethyl]-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [2-(2-benzoylphenyl)-2-oxoethyl]-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139752811 |
| Molecular Formula | C43H21BF20O4S |
| Molecular Weight | 1024.48 g/mol |
| Exact Mass | 1024.09 |
| IUPAC Name | [2-(2-benzoylphenyl)-2-oxoethyl]-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[S+](CCO)CCO)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C19H21O4S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;20-10-12-24(13-11-21)14-18(22)16-8-4-5-9-17(16)19(23)15-6-2-1-3-7-15/h;1-9,20-21H,10-14H2/q-1;+1 |
| InChIKey | UMDPEILRNJZVQP-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.48 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|