C42H21BF20O3S — CID 139752915
(2-benzoylphenyl)methyl-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139752915) has the molecular formula C42H21BF20O3S and a molecular weight of 996.47 g/mol. Its IUPAC name is (2-benzoylphenyl)methyl-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (2-benzoylphenyl)methyl-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139752915 |
| Molecular Formula | C42H21BF20O3S |
| Molecular Weight | 996.47 g/mol |
| Exact Mass | 996.10 |
| IUPAC Name | (2-benzoylphenyl)methyl-bis(2-hydroxyethyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(c1ccccc1)c1ccccc1C[S+](CCO)CCO |
| InChI | InChI=1S/C24BF20.C18H21O3S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;19-10-12-22(13-11-20)14-16-8-4-5-9-17(16)18(21)15-6-2-1-3-7-15/h;1-9,19-20H,10-14H2/q-1;+1 |
| InChIKey | WXVASJKJKNMVRK-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.47 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|