C19H15F4NO4 — CID 139752969
2,3,3,3-tetrafluoro-2-(2-methyl-7-nitro-1-benzofuran-3-yl)-1-(2-methylphenyl)propan-1-ol (PubChem CID 139752969) has the molecular formula C19H15F4NO4 and a molecular weight of 397.32 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(2-methyl-7-nitro-1-benzofuran-3-yl)-1-(2-methylphenyl)propan-1-ol.
| Compound Name | 2,3,3,3-tetrafluoro-2-(2-methyl-7-nitro-1-benzofuran-3-yl)-1-(2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 139752969 |
| Molecular Formula | C19H15F4NO4 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(2-methyl-7-nitro-1-benzofuran-3-yl)-1-(2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccccc1C(O)C(F)(c1c(C)oc2c([N+](=O)[O-])cccc12)C(F)(F)F |
| InChI | InChI=1S/C19H15F4NO4/c1-10-6-3-4-7-12(10)17(25)18(20,19(21,22)23)15-11(2)28-16-13(15)8-5-9-14(16)24(26)27/h3-9,17,25H,1-2H3 |
| InChIKey | NSAWHPOVLLAWTF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|