C11H10F3NO5 — CID 103372373
3,3,3-trifluoro-2-[(2-methyl-6-nitrophenoxy)methyl]propanoic acid (PubChem CID 103372373) has the molecular formula C11H10F3NO5 and a molecular weight of 293.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-methyl-6-nitrophenoxy)methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(2-methyl-6-nitrophenoxy)methyl]propanoic acid |
|---|---|
| PubChem CID | 103372373 |
| Molecular Formula | C11H10F3NO5 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-methyl-6-nitrophenoxy)methyl]propanoic acid |
| SMILES | Cc1cccc([N+](=O)[O-])c1OCC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO5/c1-6-3-2-4-8(15(18)19)9(6)20-5-7(10(16)17)11(12,13)14/h2-4,7H,5H2,1H3,(H,16,17) |
| InChIKey | IGSOKVZZYLAXSX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|