C10H7ClF3NO5 — CID 107718912
3-(2-chloro-6-nitrophenoxy)-4,4,4-trifluorobutanoic acid (PubChem CID 107718912) has the molecular formula C10H7ClF3NO5 and a molecular weight of 313.62 g/mol. Its IUPAC name is 3-(2-chloro-6-nitrophenoxy)-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-(2-chloro-6-nitrophenoxy)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 107718912 |
| Molecular Formula | C10H7ClF3NO5 |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 3-(2-chloro-6-nitrophenoxy)-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(Oc1c(Cl)cccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H7ClF3NO5/c11-5-2-1-3-6(15(18)19)9(5)20-7(4-8(16)17)10(12,13)14/h1-3,7H,4H2,(H,16,17) |
| InChIKey | QURRSZGZWQUDPY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|