3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid

C10H7BrF3NO5 — CID 65429643

IUPAC3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid
SMILESO=C(O)CC(Oc1ccc(Br)cc1[N+](=O)[O-])C(F)(F)F
InChIInChI=1S/C10H7BrF3NO5/c11-5-1-2-7(6(3-5)15(18)19)20-8(4-9(16)17)10(12,13)14/h1-3,8H,4H2,(H,16,17)
InChIKeyUEPVHGODUXTEII-UHFFFAOYSA-N
MW358.07 g/mol
LogP3.14
Rot. Bonds5

About 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid

3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid (PubChem CID 65429643) has the molecular formula C10H7BrF3NO5 and a molecular weight of 358.07 g/mol. Its IUPAC name is 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid.

Molecular Properties

Compound Name3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid
PubChem CID65429643
Molecular FormulaC10H7BrF3NO5
Molecular Weight358.07 g/mol
Exact Mass356.95
IUPAC Name3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid
SMILESO=C(O)CC(Oc1ccc(Br)cc1[N+](=O)[O-])C(F)(F)F
InChIInChI=1S/C10H7BrF3NO5/c11-5-1-2-7(6(3-5)15(18)19)20-8(4-9(16)17)10(12,13)14/h1-3,8H,4H2,(H,16,17)
InChIKeyUEPVHGODUXTEII-UHFFFAOYSA-N
XLogP3.14
TPSA89.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.07
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid (CID 65429643) is 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid is O=C(O)CC(Oc1ccc(Br)cc1[N+](=O)[O-])C(F)(F)F.
What is the InChIKey of 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid?
The InChIKey is UEPVHGODUXTEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF3NO5/c11-5-1-2-7(6(3-5)15(18)19)20-8(4-9(16)17)10(12,13)14/h1-3,8H,4H2,(H,16,17).
What are the key properties of 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid?
3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid has a molecular weight of 358.07 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-2-nitrophenoxy)-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 65429643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).